C37H39BO6 — CID 10555395
(4S,5S)-2-[(E)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolane (PubChem CID 10555395) has the molecular formula C37H39BO6 and a molecular weight of 590.53 g/mol. Its IUPAC name is (4S,5S)-2-[(E)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolane.
| Compound Name | (4S,5S)-2-[(E)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 10555395 |
| Molecular Formula | C37H39BO6 |
| Molecular Weight | 590.53 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | (4S,5S)-2-[(E)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolane |
| SMILES | COC(c1ccccc1)(c1ccccc1)[C@H]1OB(/C=C/[C@H]2COC(C)(C)O2)O[C@@H]1C(OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H39BO6/c1-35(2)41-27-32(42-35)25-26-38-43-33(36(39-3,28-17-9-5-10-18-28)29-19-11-6-12-20-29)34(44-38)37(40-4,30-21-13-7-14-22-30)31-23-15-8-16-24-31/h5-26,32-34H,27H2,1-4H3/b26-25+/t32-,33-,34-/m0/s1 |
| InChIKey | HMRXINXWWZIAEH-LKKNVZOSSA-N |
| XLogP | 6.69 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.53 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|