C24H26N6O8S2 — CID 10555399
3,10-bis[(2-nitrophenyl)sulfonyl]-3,6,10,16-tetrazabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene (PubChem CID 10555399) has the molecular formula C24H26N6O8S2 and a molecular weight of 590.64 g/mol. Its IUPAC name is 3,10-bis[(2-nitrophenyl)sulfonyl]-3,6,10,16-tetrazabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene.
| Compound Name | 3,10-bis[(2-nitrophenyl)sulfonyl]-3,6,10,16-tetrazabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene |
|---|---|
| PubChem CID | 10555399 |
| Molecular Formula | C24H26N6O8S2 |
| Molecular Weight | 590.64 g/mol |
| Exact Mass | 590.13 |
| IUPAC Name | 3,10-bis[(2-nitrophenyl)sulfonyl]-3,6,10,16-tetrazabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)N1CCCNCCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])Cc2cccc(n2)C1 |
| InChI | InChI=1S/C24H26N6O8S2/c31-29(32)21-9-1-3-11-23(21)39(35,36)27-15-6-13-25-14-16-28(18-20-8-5-7-19(17-27)26-20)40(37,38)24-12-4-2-10-22(24)30(33)34/h1-5,7-12,25H,6,13-18H2 |
| InChIKey | OFGBNIMHNGVJEZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 185.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.64 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|