C31H44N3O9P — CID 10556032
(4S)-4-[[(2S)-2-benzamido-3-(4-phosphonooxyphenyl)propanoyl]amino]-5-(dipentylamino)-5-oxopentanoic acid (PubChem CID 10556032) has the molecular formula C31H44N3O9P and a molecular weight of 633.68 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-benzamido-3-(4-phosphonooxyphenyl)propanoyl]amino]-5-(dipentylamino)-5-oxopentanoic acid.
| Compound Name | (4S)-4-[[(2S)-2-benzamido-3-(4-phosphonooxyphenyl)propanoyl]amino]-5-(dipentylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 10556032 |
| Molecular Formula | C31H44N3O9P |
| Molecular Weight | 633.68 g/mol |
| Exact Mass | 633.28 |
| IUPAC Name | (4S)-4-[[(2S)-2-benzamido-3-(4-phosphonooxyphenyl)propanoyl]amino]-5-(dipentylamino)-5-oxopentanoic acid |
| SMILES | CCCCCN(CCCCC)C(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc1ccc(OP(=O)(O)O)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H44N3O9P/c1-3-5-10-20-34(21-11-6-4-2)31(39)26(18-19-28(35)36)32-30(38)27(33-29(37)24-12-8-7-9-13-24)22-23-14-16-25(17-15-23)43-44(40,41)42/h7-9,12-17,26-27H,3-6,10-11,18-22H2,1-2H3,(H,32,38)(H,33,37)(H,35,36)(H2,40,41,42)/t26-,27-/m0/s1 |
| InChIKey | LILVUPGYEJGKAZ-SVBPBHIXSA-N |
| XLogP | 4.06 |
| TPSA | 182.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.68 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|