C31H43F3N4O5Si — CID 10556075
N-[2-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoro-4-methylpentan-3-yl]-2-[3-(2-methyl-1-phenylpropan-2-yl)-2,4,8-trioxo-1H-pyrido[3,4-d]pyrimidin-7-yl]acetamide (PubChem CID 10556075) has the molecular formula C31H43F3N4O5Si and a molecular weight of 636.79 g/mol. Its IUPAC name is N-[2-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoro-4-methylpentan-3-yl]-2-[3-(2-methyl-1-phenylpropan-2-yl)-2,4,8-trioxo-1H-pyrido[3,4-d]pyrimidin-7-yl]acetamide.
| Compound Name | N-[2-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoro-4-methylpentan-3-yl]-2-[3-(2-methyl-1-phenylpropan-2-yl)-2,4,8-trioxo-1H-pyrido[3,4-d]pyrimidin-7-yl]acetamide |
|---|---|
| PubChem CID | 10556075 |
| Molecular Formula | C31H43F3N4O5Si |
| Molecular Weight | 636.79 g/mol |
| Exact Mass | 636.30 |
| IUPAC Name | N-[2-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoro-4-methylpentan-3-yl]-2-[3-(2-methyl-1-phenylpropan-2-yl)-2,4,8-trioxo-1H-pyrido[3,4-d]pyrimidin-7-yl]acetamide |
| SMILES | CC(C)C(NC(=O)Cn1ccc2c(=O)n(C(C)(C)Cc3ccccc3)c(=O)[nH]c2c1=O)C(O[Si](C)(C)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C31H43F3N4O5Si/c1-19(2)23(25(31(32,33)34)43-44(8,9)29(3,4)5)35-22(39)18-37-16-15-21-24(27(37)41)36-28(42)38(26(21)40)30(6,7)17-20-13-11-10-12-14-20/h10-16,19,23,25H,17-18H2,1-9H3,(H,35,39)(H,36,42) |
| InChIKey | WQKYIXFZVXKEMR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.79 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|