C31H32Cl3NO7 — CID 10556080
[(3S,4S,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate (PubChem CID 10556080) has the molecular formula C31H32Cl3NO7 and a molecular weight of 636.96 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 10556080 |
| Molecular Formula | C31H32Cl3NO7 |
| Molecular Weight | 636.96 g/mol |
| Exact Mass | 635.12 |
| IUPAC Name | [(3S,4S,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
| SMILES | [H]/N=C(/OC1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C31H32Cl3NO7/c1-21(36)40-28-27(39-19-24-15-9-4-10-16-24)26(38-18-23-13-7-3-8-14-23)25(20-37-17-22-11-5-2-6-12-22)41-29(28)42-30(35)31(32,33)34/h2-16,25-29,35H,17-20H2,1H3/b35-30+/t25-,26-,27+,28+,29?/m1/s1 |
| InChIKey | PBGJEKBBQZONHS-VLSWWLJISA-N |
| XLogP | 6.39 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.96 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|