C33H42O3Se2 — CID 10556151
(5Z)-5-[(2,6-ditert-butylselenopyran-1-ium-4-yl)methylidene]-2-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]-3,4-dioxocyclopenten-1-olate (PubChem CID 10556151) has the molecular formula C33H42O3Se2 and a molecular weight of 644.62 g/mol. Its IUPAC name is (5Z)-5-[(2,6-ditert-butylselenopyran-1-ium-4-yl)methylidene]-2-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]-3,4-dioxocyclopenten-1-olate.
| Compound Name | (5Z)-5-[(2,6-ditert-butylselenopyran-1-ium-4-yl)methylidene]-2-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]-3,4-dioxocyclopenten-1-olate |
|---|---|
| PubChem CID | 10556151 |
| Molecular Formula | C33H42O3Se2 |
| Molecular Weight | 644.62 g/mol |
| Exact Mass | 646.15 |
| IUPAC Name | (5Z)-5-[(2,6-ditert-butylselenopyran-1-ium-4-yl)methylidene]-2-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]-3,4-dioxocyclopenten-1-olate |
| SMILES | CC(C)(C)C1=CC(=CC2=C([O-])/C(=C/c3cc(C(C)(C)C)[se+]c(C(C)(C)C)c3)C(=O)C2=O)C=C(C(C)(C)C)[Se]1 |
| InChI | InChI=1S/C33H42O3Se2/c1-30(2,3)23-15-19(16-24(37-23)31(4,5)6)13-21-27(34)22(29(36)28(21)35)14-20-17-25(32(7,8)9)38-26(18-20)33(10,11)12/h13-18H,1-12H3 |
| InChIKey | SZFIAKHNCDGALE-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.62 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|