C29H23F6NO4S3 — CID 10556299
3-[4-[4-[3,3,4,4,5,5-hexafluoro-2-[5-(4-hydroxyphenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-5-methylthiophen-2-yl]pyridin-1-ium-1-yl]propane-1-sulfonate (PubChem CID 10556299) has the molecular formula C29H23F6NO4S3 and a molecular weight of 659.70 g/mol. Its IUPAC name is 3-[4-[4-[3,3,4,4,5,5-hexafluoro-2-[5-(4-hydroxyphenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-5-methylthiophen-2-yl]pyridin-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[4-[4-[3,3,4,4,5,5-hexafluoro-2-[5-(4-hydroxyphenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-5-methylthiophen-2-yl]pyridin-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 10556299 |
| Molecular Formula | C29H23F6NO4S3 |
| Molecular Weight | 659.70 g/mol |
| Exact Mass | 659.07 |
| IUPAC Name | 3-[4-[4-[3,3,4,4,5,5-hexafluoro-2-[5-(4-hydroxyphenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-5-methylthiophen-2-yl]pyridin-1-ium-1-yl]propane-1-sulfonate |
| SMILES | Cc1sc(-c2ccc(O)cc2)cc1C1=C(c2cc(-c3cc[n+](CCCS(=O)(=O)[O-])cc3)sc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C29H23F6NO4S3/c1-16-21(14-23(41-16)18-4-6-20(37)7-5-18)25-26(28(32,33)29(34,35)27(25,30)31)22-15-24(42-17(22)2)19-8-11-36(12-9-19)10-3-13-43(38,39)40/h4-9,11-12,14-15H,3,10,13H2,1-2H3,(H-,37,38,39,40) |
| InChIKey | HSBKFBUFCZWQSM-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.70 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|