C39H54O3S2Si — CID 10556329
methyl 4-[2-[(1E,3Z,5E,7S,9Z)-7-[tert-butyl(diphenyl)silyl]oxypentadeca-1,3,5,9-tetraenyl]-1,3-dithiolan-2-yl]butanoate (PubChem CID 10556329) has the molecular formula C39H54O3S2Si and a molecular weight of 663.08 g/mol. Its IUPAC name is methyl 4-[2-[(1E,3Z,5E,7S,9Z)-7-[tert-butyl(diphenyl)silyl]oxypentadeca-1,3,5,9-tetraenyl]-1,3-dithiolan-2-yl]butanoate.
| Compound Name | methyl 4-[2-[(1E,3Z,5E,7S,9Z)-7-[tert-butyl(diphenyl)silyl]oxypentadeca-1,3,5,9-tetraenyl]-1,3-dithiolan-2-yl]butanoate |
|---|---|
| PubChem CID | 10556329 |
| Molecular Formula | C39H54O3S2Si |
| Molecular Weight | 663.08 g/mol |
| Exact Mass | 662.33 |
| IUPAC Name | methyl 4-[2-[(1E,3Z,5E,7S,9Z)-7-[tert-butyl(diphenyl)silyl]oxypentadeca-1,3,5,9-tetraenyl]-1,3-dithiolan-2-yl]butanoate |
| SMILES | CCCCC/C=C\C[C@@H](/C=C/C=C\C=C\C1(CCCC(=O)OC)SCCS1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C39H54O3S2Si/c1-6-7-8-9-10-15-23-34(24-16-11-12-21-30-39(43-32-33-44-39)31-22-29-37(40)41-5)42-45(38(2,3)4,35-25-17-13-18-26-35)36-27-19-14-20-28-36/h10-21,24-28,30,34H,6-9,22-23,29,31-33H2,1-5H3/b12-11-,15-10-,24-16+,30-21+/t34-/m0/s1 |
| InChIKey | AZXKEUWDZGALDJ-FJYQEDQLSA-N |
| XLogP | 9.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.08 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|