C40H60O6Si — CID 10556348
[(2S,4R)-4-[(2S,3S,5R,6R,8R)-2-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-3,5-dimethyl-1,7-dioxaspiro[5.5]undec-10-en-8-yl]-2-ethyl-2-hydroxypentyl] acetate (PubChem CID 10556348) has the molecular formula C40H60O6Si and a molecular weight of 665.00 g/mol. Its IUPAC name is [(2S,4R)-4-[(2S,3S,5R,6R,8R)-2-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-3,5-dimethyl-1,7-dioxaspiro[5.5]undec-10-en-8-yl]-2-ethyl-2-hydroxypentyl] acetate.
| Compound Name | [(2S,4R)-4-[(2S,3S,5R,6R,8R)-2-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-3,5-dimethyl-1,7-dioxaspiro[5.5]undec-10-en-8-yl]-2-ethyl-2-hydroxypentyl] acetate |
|---|---|
| PubChem CID | 10556348 |
| Molecular Formula | C40H60O6Si |
| Molecular Weight | 665.00 g/mol |
| Exact Mass | 664.42 |
| IUPAC Name | [(2S,4R)-4-[(2S,3S,5R,6R,8R)-2-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-3,5-dimethyl-1,7-dioxaspiro[5.5]undec-10-en-8-yl]-2-ethyl-2-hydroxypentyl] acetate |
| SMILES | CC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1O[C@@]2(C=CC[C@H]([C@H](C)C[C@@](O)(CC)COC(C)=O)O2)[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C40H60O6Si/c1-10-33(27-44-47(38(7,8)9,34-19-14-12-15-20-34)35-21-16-13-17-22-35)37-29(3)25-31(5)40(46-37)24-18-23-36(45-40)30(4)26-39(42,11-2)28-43-32(6)41/h12-22,24,29-31,33,36-37,42H,10-11,23,25-28H2,1-9H3/t29-,30+,31+,33-,36+,37-,39-,40-/m0/s1 |
| InChIKey | LJVWYYHPACJIPE-LBCQNXIHSA-N |
| XLogP | 7.42 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.00 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|