C42H39N5O4 — CID 10556460
2-[3-[(1-benzylindazol-3-yl)methyl]-2,4-dioxo-5-phenyl-1,5-benzodiazepin-1-yl]-N-(4-methoxyphenyl)-N-propan-2-ylacetamide (PubChem CID 10556460) has the molecular formula C42H39N5O4 and a molecular weight of 677.81 g/mol. Its IUPAC name is 2-[3-[(1-benzylindazol-3-yl)methyl]-2,4-dioxo-5-phenyl-1,5-benzodiazepin-1-yl]-N-(4-methoxyphenyl)-N-propan-2-ylacetamide.
| Compound Name | 2-[3-[(1-benzylindazol-3-yl)methyl]-2,4-dioxo-5-phenyl-1,5-benzodiazepin-1-yl]-N-(4-methoxyphenyl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 10556460 |
| Molecular Formula | C42H39N5O4 |
| Molecular Weight | 677.81 g/mol |
| Exact Mass | 677.30 |
| IUPAC Name | 2-[3-[(1-benzylindazol-3-yl)methyl]-2,4-dioxo-5-phenyl-1,5-benzodiazepin-1-yl]-N-(4-methoxyphenyl)-N-propan-2-ylacetamide |
| SMILES | COc1ccc(N(C(=O)CN2C(=O)C(Cc3nn(Cc4ccccc4)c4ccccc34)C(=O)N(c3ccccc3)c3ccccc32)C(C)C)cc1 |
| InChI | InChI=1S/C42H39N5O4/c1-29(2)46(32-22-24-33(51-3)25-23-32)40(48)28-44-38-20-12-13-21-39(38)47(31-16-8-5-9-17-31)42(50)35(41(44)49)26-36-34-18-10-11-19-37(34)45(43-36)27-30-14-6-4-7-15-30/h4-25,29,35H,26-28H2,1-3H3 |
| InChIKey | WKUGDHYDAPFFHF-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 87.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.81 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|