C44H45FeN2O3P+2 — CID 10556935
CID 10556935 (PubChem CID 10556935) has the molecular formula C44H45FeN2O3P+2 and a molecular weight of 736.67 g/mol.
| Compound Name | CID 10556935 |
|---|---|
| PubChem CID | 10556935 |
| Molecular Formula | C44H45FeN2O3P+2 |
| Molecular Weight | 736.67 g/mol |
| Exact Mass | 736.25 |
| IUPAC Name | — |
| SMILES | CCC(=O)C[C@@H]1CC(C(=O)OC)=C2Nc3ccccc3[C@@]23CCN([C@H](C)[C]2[CH][CH][CH][C]2P(c2ccccc2)c2ccccc2)[C@@H]13.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C39H40N2O3P.C5H5.Fe/c1-4-28(42)24-27-25-32(38(43)44-3)36-39(33-19-11-12-20-34(33)40-36)22-23-41(37(27)39)26(2)31-18-13-21-35(31)45(29-14-7-5-8-15-29)30-16-9-6-10-17-30;1-2-4-5-3-1;/h5-21,26-27,37,40H,4,22-25H2,1-3H3;1-5H;/q;;+2/t26-,27-,37+,39+;;/m1../s1 |
| InChIKey | PIBXHOHTHIZBQJ-BCSVZQSKSA-N |
| XLogP | 7.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.67 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|