C40H61N3O6S3 — CID 10557160
2,4,6-trimethyl-N-propyl-N-[4-[3-[propyl-(2,4,6-trimethylphenyl)sulfonylamino]propyl-(2,4,6-trimethylphenyl)sulfonylamino]butyl]benzenesulfonamide (PubChem CID 10557160) has the molecular formula C40H61N3O6S3 and a molecular weight of 776.14 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-propyl-N-[4-[3-[propyl-(2,4,6-trimethylphenyl)sulfonylamino]propyl-(2,4,6-trimethylphenyl)sulfonylamino]butyl]benzenesulfonamide.
| Compound Name | 2,4,6-trimethyl-N-propyl-N-[4-[3-[propyl-(2,4,6-trimethylphenyl)sulfonylamino]propyl-(2,4,6-trimethylphenyl)sulfonylamino]butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10557160 |
| Molecular Formula | C40H61N3O6S3 |
| Molecular Weight | 776.14 g/mol |
| Exact Mass | 775.37 |
| IUPAC Name | 2,4,6-trimethyl-N-propyl-N-[4-[3-[propyl-(2,4,6-trimethylphenyl)sulfonylamino]propyl-(2,4,6-trimethylphenyl)sulfonylamino]butyl]benzenesulfonamide |
| SMILES | CCCN(CCCCN(CCCN(CCC)S(=O)(=O)c1c(C)cc(C)cc1C)S(=O)(=O)c1c(C)cc(C)cc1C)S(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C40H61N3O6S3/c1-12-17-41(50(44,45)38-32(6)23-29(3)24-33(38)7)19-14-15-20-43(52(48,49)40-36(10)27-31(5)28-37(40)11)22-16-21-42(18-13-2)51(46,47)39-34(8)25-30(4)26-35(39)9/h23-28H,12-22H2,1-11H3 |
| InChIKey | HGNSUECWOCICKW-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.14 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|