C14H16F12O2 — CID 10557498
1,1,1,3,3,3-hexafluoro-2-[[(1R,2R)-2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl]methyl]propan-2-ol (PubChem CID 10557498) has the molecular formula C14H16F12O2 and a molecular weight of 444.26 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[[(1R,2R)-2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl]methyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[[(1R,2R)-2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl]methyl]propan-2-ol |
|---|---|
| PubChem CID | 10557498 |
| Molecular Formula | C14H16F12O2 |
| Molecular Weight | 444.26 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[[(1R,2R)-2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl]methyl]propan-2-ol |
| SMILES | OC(C[C@H]1CCCC[C@@H]1CC(O)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H16F12O2/c15-11(16,17)9(27,12(18,19)20)5-7-3-1-2-4-8(7)6-10(28,13(21,22)23)14(24,25)26/h7-8,27-28H,1-6H2/t7-,8-/m1/s1 |
| InChIKey | ZLZQVOBDICFPIS-HTQZYQBOSA-N |
| XLogP | 5.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.26 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |