C4H10 — CID 10558567
1,1,1,2,3,3,3-heptadeuterio-2-(trideuteriomethyl)propane (PubChem CID 10558567) has the molecular formula C4H10 and a molecular weight of 68.19 g/mol. Its IUPAC name is 1,1,1,2,3,3,3-heptadeuterio-2-(trideuteriomethyl)propane.
| Compound Name | 1,1,1,2,3,3,3-heptadeuterio-2-(trideuteriomethyl)propane |
|---|---|
| PubChem CID | 10558567 |
| Molecular Formula | C4H10 |
| Molecular Weight | 68.19 g/mol |
| Exact Mass | 68.14 |
| IUPAC Name | 1,1,1,2,3,3,3-heptadeuterio-2-(trideuteriomethyl)propane |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C4H10/c1-4(2)3/h4H,1-3H3/i1D3,2D3,3D3,4D |
| InChIKey | NNPPMTNAJDCUHE-LSURFNHSSA-N |
| XLogP | 1.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 68.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |