C7H10O — CID 10558581
(3S,4R)-4-methylhex-5-en-1-yn-3-ol (PubChem CID 10558581) has the molecular formula C7H10O and a molecular weight of 110.16 g/mol. Its IUPAC name is (3S,4R)-4-methylhex-5-en-1-yn-3-ol.
| Compound Name | (3S,4R)-4-methylhex-5-en-1-yn-3-ol |
|---|---|
| PubChem CID | 10558581 |
| Molecular Formula | C7H10O |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.07 |
| IUPAC Name | (3S,4R)-4-methylhex-5-en-1-yn-3-ol |
| SMILES | C#C[C@@H](O)[C@H](C)C=C |
| InChI | InChI=1S/C7H10O/c1-4-6(3)7(8)5-2/h2,4,6-8H,1H2,3H3/t6-,7-/m1/s1 |
| InChIKey | BGLQRZSQWFALBB-RNFRBKRXSA-N |
| XLogP | 0.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|