About 4-fluorobenzene-1,3-diol
4-fluorobenzene-1,3-diol (PubChem CID 10558640) has the molecular formula C6H5FO2
and a molecular weight of 128.10 g/mol. Its IUPAC name is 4-fluorobenzene-1,3-diol.
Molecular Properties
| Compound Name | 4-fluorobenzene-1,3-diol |
| PubChem CID | 10558640 |
| Molecular Formula | C6H5FO2 |
| Molecular Weight | 128.10 g/mol |
| Exact Mass | 128.03 |
| IUPAC Name | 4-fluorobenzene-1,3-diol |
| SMILES | Oc1ccc(F)c(O)c1 |
| InChI | InChI=1S/C6H5FO2/c7-5-2-1-4(8)3-6(5)9/h1-3,8-9H |
| InChIKey | XPOIJNIQXJYQOV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.10 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluorobenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorobenzene-1,3-diol?
The IUPAC name of 4-fluorobenzene-1,3-diol (CID 10558640) is 4-fluorobenzene-1,3-diol.
What is the SMILES notation for 4-fluorobenzene-1,3-diol?
The canonical SMILES for 4-fluorobenzene-1,3-diol is Oc1ccc(F)c(O)c1.
What is the InChIKey of 4-fluorobenzene-1,3-diol?
The InChIKey is XPOIJNIQXJYQOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FO2/c7-5-2-1-4(8)3-6(5)9/h1-3,8-9H.
What are the key properties of 4-fluorobenzene-1,3-diol?
4-fluorobenzene-1,3-diol has a molecular weight of 128.10 g/mol, XLogP of 1.24, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorobenzene-1,3-diol is sourced from PubChem (CID 10558640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).