About 2-N-propan-2-ylbenzene-1,2-diamine
2-N-propan-2-ylbenzene-1,2-diamine (PubChem CID 10558787) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-N-propan-2-ylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-propan-2-ylbenzene-1,2-diamine |
| PubChem CID | 10558787 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2-N-propan-2-ylbenzene-1,2-diamine |
| SMILES | CC(C)Nc1ccccc1N |
| InChI | InChI=1S/C9H14N2/c1-7(2)11-9-6-4-3-5-8(9)10/h3-7,11H,10H2,1-2H3 |
| InChIKey | NUANSJJRMWHEHS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-N-propan-2-ylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-propan-2-ylbenzene-1,2-diamine?
The IUPAC name of 2-N-propan-2-ylbenzene-1,2-diamine (CID 10558787) is 2-N-propan-2-ylbenzene-1,2-diamine.
What is the SMILES notation for 2-N-propan-2-ylbenzene-1,2-diamine?
The canonical SMILES for 2-N-propan-2-ylbenzene-1,2-diamine is CC(C)Nc1ccccc1N.
What is the InChIKey of 2-N-propan-2-ylbenzene-1,2-diamine?
The InChIKey is NUANSJJRMWHEHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-7(2)11-9-6-4-3-5-8(9)10/h3-7,11H,10H2,1-2H3.
What are the key properties of 2-N-propan-2-ylbenzene-1,2-diamine?
2-N-propan-2-ylbenzene-1,2-diamine has a molecular weight of 150.22 g/mol, XLogP of 2.09, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-propan-2-ylbenzene-1,2-diamine is sourced from PubChem (CID 10558787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).