About 6-(hydroxymethyl)-2,2-dimethyl-3,4-dihydropyran-4-ol
6-(hydroxymethyl)-2,2-dimethyl-3,4-dihydropyran-4-ol (PubChem CID 10558895) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is 6-(hydroxymethyl)-2,2-dimethyl-3,4-dihydropyran-4-ol.
Molecular Properties
| Compound Name | 6-(hydroxymethyl)-2,2-dimethyl-3,4-dihydropyran-4-ol |
| PubChem CID | 10558895 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 6-(hydroxymethyl)-2,2-dimethyl-3,4-dihydropyran-4-ol |
| SMILES | CC1(C)CC(O)C=C(CO)O1 |
| InChI | InChI=1S/C8H14O3/c1-8(2)4-6(10)3-7(5-9)11-8/h3,6,9-10H,4-5H2,1-2H3 |
| InChIKey | KRINXDJHVHVDFQ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(hydroxymethyl)-2,2-dimethyl-3,4-dihydropyran-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hydroxymethyl)-2,2-dimethyl-3,4-dihydropyran-4-ol?
The IUPAC name of 6-(hydroxymethyl)-2,2-dimethyl-3,4-dihydropyran-4-ol (CID 10558895) is 6-(hydroxymethyl)-2,2-dimethyl-3,4-dihydropyran-4-ol.
What is the SMILES notation for 6-(hydroxymethyl)-2,2-dimethyl-3,4-dihydropyran-4-ol?
The canonical SMILES for 6-(hydroxymethyl)-2,2-dimethyl-3,4-dihydropyran-4-ol is CC1(C)CC(O)C=C(CO)O1.
What is the InChIKey of 6-(hydroxymethyl)-2,2-dimethyl-3,4-dihydropyran-4-ol?
The InChIKey is KRINXDJHVHVDFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-8(2)4-6(10)3-7(5-9)11-8/h3,6,9-10H,4-5H2,1-2H3.
What are the key properties of 6-(hydroxymethyl)-2,2-dimethyl-3,4-dihydropyran-4-ol?
6-(hydroxymethyl)-2,2-dimethyl-3,4-dihydropyran-4-ol has a molecular weight of 158.20 g/mol, XLogP of 0.42, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hydroxymethyl)-2,2-dimethyl-3,4-dihydropyran-4-ol is sourced from PubChem (CID 10558895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).