C10H15NO — CID 10558983
2,3,6,7,10,10a-hexahydro-1H-pyrido[1,2-a]azepin-4-one (PubChem CID 10558983) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 2,3,6,7,10,10a-hexahydro-1H-pyrido[1,2-a]azepin-4-one.
| Compound Name | 2,3,6,7,10,10a-hexahydro-1H-pyrido[1,2-a]azepin-4-one |
|---|---|
| PubChem CID | 10558983 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 2,3,6,7,10,10a-hexahydro-1H-pyrido[1,2-a]azepin-4-one |
| SMILES | O=C1CCCC2CC=CCCN12 |
| InChI | InChI=1S/C10H15NO/c12-10-7-4-6-9-5-2-1-3-8-11(9)10/h1-2,9H,3-8H2 |
| InChIKey | MIYMTWLRENVZJV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|