About N'-(dicyclopropylmethyl)-N-methylethane-1,2-diamine
N'-(dicyclopropylmethyl)-N-methylethane-1,2-diamine (PubChem CID 10559045) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is N'-(dicyclopropylmethyl)-N-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(dicyclopropylmethyl)-N-methylethane-1,2-diamine |
| PubChem CID | 10559045 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N'-(dicyclopropylmethyl)-N-methylethane-1,2-diamine |
| SMILES | CNCCNC(C1CC1)C1CC1 |
| InChI | InChI=1S/C10H20N2/c1-11-6-7-12-10(8-2-3-8)9-4-5-9/h8-12H,2-7H2,1H3 |
| InChIKey | OUHPFBCXWUKRGM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(dicyclopropylmethyl)-N-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(dicyclopropylmethyl)-N-methylethane-1,2-diamine?
The IUPAC name of N'-(dicyclopropylmethyl)-N-methylethane-1,2-diamine (CID 10559045) is N'-(dicyclopropylmethyl)-N-methylethane-1,2-diamine.
What is the SMILES notation for N'-(dicyclopropylmethyl)-N-methylethane-1,2-diamine?
The canonical SMILES for N'-(dicyclopropylmethyl)-N-methylethane-1,2-diamine is CNCCNC(C1CC1)C1CC1.
What is the InChIKey of N'-(dicyclopropylmethyl)-N-methylethane-1,2-diamine?
The InChIKey is OUHPFBCXWUKRGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-11-6-7-12-10(8-2-3-8)9-4-5-9/h8-12H,2-7H2,1H3.
What are the key properties of N'-(dicyclopropylmethyl)-N-methylethane-1,2-diamine?
N'-(dicyclopropylmethyl)-N-methylethane-1,2-diamine has a molecular weight of 168.28 g/mol, XLogP of 0.98, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(dicyclopropylmethyl)-N-methylethane-1,2-diamine is sourced from PubChem (CID 10559045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).