About (3-formamidocyclohexyl) formate
(3-formamidocyclohexyl) formate (PubChem CID 10559091) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is (3-formamidocyclohexyl) formate.
Molecular Properties
| Compound Name | (3-formamidocyclohexyl) formate |
| PubChem CID | 10559091 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (3-formamidocyclohexyl) formate |
| SMILES | O=CNC1CCCC(OC=O)C1 |
| InChI | InChI=1S/C8H13NO3/c10-5-9-7-2-1-3-8(4-7)12-6-11/h5-8H,1-4H2,(H,9,10) |
| InChIKey | MDSXMTNEENKYNZ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3-formamidocyclohexyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-formamidocyclohexyl) formate?
The IUPAC name of (3-formamidocyclohexyl) formate (CID 10559091) is (3-formamidocyclohexyl) formate.
What is the SMILES notation for (3-formamidocyclohexyl) formate?
The canonical SMILES for (3-formamidocyclohexyl) formate is O=CNC1CCCC(OC=O)C1.
What is the InChIKey of (3-formamidocyclohexyl) formate?
The InChIKey is MDSXMTNEENKYNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c10-5-9-7-2-1-3-8(4-7)12-6-11/h5-8H,1-4H2,(H,9,10).
What are the key properties of (3-formamidocyclohexyl) formate?
(3-formamidocyclohexyl) formate has a molecular weight of 171.20 g/mol, XLogP of 0.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-formamidocyclohexyl) formate is sourced from PubChem (CID 10559091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).