About 1,2-dihydropyrrolo[1,2-a]indol-3-one
1,2-dihydropyrrolo[1,2-a]indol-3-one (PubChem CID 10559092) has the molecular formula C11H9NO
and a molecular weight of 171.20 g/mol. Its IUPAC name is 1,2-dihydropyrrolo[1,2-a]indol-3-one.
Molecular Properties
| Compound Name | 1,2-dihydropyrrolo[1,2-a]indol-3-one |
| PubChem CID | 10559092 |
| Molecular Formula | C11H9NO |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 1,2-dihydropyrrolo[1,2-a]indol-3-one |
| SMILES | O=C1CCn2c1cc1ccccc12 |
| InChI | InChI=1S/C11H9NO/c13-11-5-6-12-9-4-2-1-3-8(9)7-10(11)12/h1-4,7H,5-6H2 |
| InChIKey | LYKSBSFEUFSEIQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dihydropyrrolo[1,2-a]indol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydropyrrolo[1,2-a]indol-3-one?
The IUPAC name of 1,2-dihydropyrrolo[1,2-a]indol-3-one (CID 10559092) is 1,2-dihydropyrrolo[1,2-a]indol-3-one.
What is the SMILES notation for 1,2-dihydropyrrolo[1,2-a]indol-3-one?
The canonical SMILES for 1,2-dihydropyrrolo[1,2-a]indol-3-one is O=C1CCn2c1cc1ccccc12.
What is the InChIKey of 1,2-dihydropyrrolo[1,2-a]indol-3-one?
The InChIKey is LYKSBSFEUFSEIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO/c13-11-5-6-12-9-4-2-1-3-8(9)7-10(11)12/h1-4,7H,5-6H2.
What are the key properties of 1,2-dihydropyrrolo[1,2-a]indol-3-one?
1,2-dihydropyrrolo[1,2-a]indol-3-one has a molecular weight of 171.20 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydropyrrolo[1,2-a]indol-3-one is sourced from PubChem (CID 10559092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).