About ethyl 6-aminooxyhexanoate
ethyl 6-aminooxyhexanoate (PubChem CID 10559164) has the molecular formula C8H17NO3
and a molecular weight of 175.23 g/mol. Its IUPAC name is ethyl 6-aminooxyhexanoate.
Molecular Properties
| Compound Name | ethyl 6-aminooxyhexanoate |
| PubChem CID | 10559164 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | ethyl 6-aminooxyhexanoate |
| SMILES | CCOC(=O)CCCCCON |
| InChI | InChI=1S/C8H17NO3/c1-2-11-8(10)6-4-3-5-7-12-9/h2-7,9H2,1H3 |
| InChIKey | KOWHXWZAOIIGMW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-aminooxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-aminooxyhexanoate?
The IUPAC name of ethyl 6-aminooxyhexanoate (CID 10559164) is ethyl 6-aminooxyhexanoate.
What is the SMILES notation for ethyl 6-aminooxyhexanoate?
The canonical SMILES for ethyl 6-aminooxyhexanoate is CCOC(=O)CCCCCON.
What is the InChIKey of ethyl 6-aminooxyhexanoate?
The InChIKey is KOWHXWZAOIIGMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO3/c1-2-11-8(10)6-4-3-5-7-12-9/h2-7,9H2,1H3.
What are the key properties of ethyl 6-aminooxyhexanoate?
ethyl 6-aminooxyhexanoate has a molecular weight of 175.23 g/mol, XLogP of 1.00, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-aminooxyhexanoate is sourced from PubChem (CID 10559164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).