About [4-(1,3-dioxolan-2-yl)phenyl]methanamine
[4-(1,3-dioxolan-2-yl)phenyl]methanamine (PubChem CID 10559254) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is [4-(1,3-dioxolan-2-yl)phenyl]methanamine.
Molecular Properties
| Compound Name | [4-(1,3-dioxolan-2-yl)phenyl]methanamine |
| PubChem CID | 10559254 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | [4-(1,3-dioxolan-2-yl)phenyl]methanamine |
| SMILES | NCc1ccc(C2OCCO2)cc1 |
| InChI | InChI=1S/C10H13NO2/c11-7-8-1-3-9(4-2-8)10-12-5-6-13-10/h1-4,10H,5-7,11H2 |
| InChIKey | NUKQIICQHKOVHB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(1,3-dioxolan-2-yl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,3-dioxolan-2-yl)phenyl]methanamine?
The IUPAC name of [4-(1,3-dioxolan-2-yl)phenyl]methanamine (CID 10559254) is [4-(1,3-dioxolan-2-yl)phenyl]methanamine.
What is the SMILES notation for [4-(1,3-dioxolan-2-yl)phenyl]methanamine?
The canonical SMILES for [4-(1,3-dioxolan-2-yl)phenyl]methanamine is NCc1ccc(C2OCCO2)cc1.
What is the InChIKey of [4-(1,3-dioxolan-2-yl)phenyl]methanamine?
The InChIKey is NUKQIICQHKOVHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c11-7-8-1-3-9(4-2-8)10-12-5-6-13-10/h1-4,10H,5-7,11H2.
What are the key properties of [4-(1,3-dioxolan-2-yl)phenyl]methanamine?
[4-(1,3-dioxolan-2-yl)phenyl]methanamine has a molecular weight of 179.22 g/mol, XLogP of 1.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,3-dioxolan-2-yl)phenyl]methanamine is sourced from PubChem (CID 10559254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).