C10H18O3 — CID 10559461
(3aS,4R,5S,6S,6aS)-4,5,6a-trimethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-3a,6-diol (PubChem CID 10559461) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (3aS,4R,5S,6S,6aS)-4,5,6a-trimethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-3a,6-diol.
| Compound Name | (3aS,4R,5S,6S,6aS)-4,5,6a-trimethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-3a,6-diol |
|---|---|
| PubChem CID | 10559461 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (3aS,4R,5S,6S,6aS)-4,5,6a-trimethyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-3a,6-diol |
| SMILES | C[C@H]1[C@@H](C)[C@@]2(O)CCO[C@@]2(C)[C@H]1O |
| InChI | InChI=1S/C10H18O3/c1-6-7(2)10(12)4-5-13-9(10,3)8(6)11/h6-8,11-12H,4-5H2,1-3H3/t6-,7+,8-,9-,10-/m0/s1 |
| InChIKey | SPMRERMTEODMOL-SVSWQMSJSA-N |
| XLogP | 0.54 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |