C12H16O2 — CID 10559650
2-butyl-2-prop-2-ynylcyclopentane-1,3-dione (PubChem CID 10559650) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-butyl-2-prop-2-ynylcyclopentane-1,3-dione.
| Compound Name | 2-butyl-2-prop-2-ynylcyclopentane-1,3-dione |
|---|---|
| PubChem CID | 10559650 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2-butyl-2-prop-2-ynylcyclopentane-1,3-dione |
| SMILES | C#CCC1(CCCC)C(=O)CCC1=O |
| InChI | InChI=1S/C12H16O2/c1-3-5-9-12(8-4-2)10(13)6-7-11(12)14/h2H,3,5-9H2,1H3 |
| InChIKey | XPMBNZMCRJFUCZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|