About 8-methoxy-1H-3,1-benzoxazine-2,4-dione
8-methoxy-1H-3,1-benzoxazine-2,4-dione (PubChem CID 10559679) has the molecular formula C9H7NO4
and a molecular weight of 193.16 g/mol. Its IUPAC name is 8-methoxy-1H-3,1-benzoxazine-2,4-dione.
Molecular Properties
| Compound Name | 8-methoxy-1H-3,1-benzoxazine-2,4-dione |
| PubChem CID | 10559679 |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 8-methoxy-1H-3,1-benzoxazine-2,4-dione |
| SMILES | COc1cccc2c(=O)oc(=O)[nH]c12 |
| InChI | InChI=1S/C9H7NO4/c1-13-6-4-2-3-5-7(6)10-9(12)14-8(5)11/h2-4H,1H3,(H,10,12) |
| InChIKey | ZPTOZGCACQWXJX-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methoxy-1H-3,1-benzoxazine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-1H-3,1-benzoxazine-2,4-dione?
The IUPAC name of 8-methoxy-1H-3,1-benzoxazine-2,4-dione (CID 10559679) is 8-methoxy-1H-3,1-benzoxazine-2,4-dione.
What is the SMILES notation for 8-methoxy-1H-3,1-benzoxazine-2,4-dione?
The canonical SMILES for 8-methoxy-1H-3,1-benzoxazine-2,4-dione is COc1cccc2c(=O)oc(=O)[nH]c12.
What is the InChIKey of 8-methoxy-1H-3,1-benzoxazine-2,4-dione?
The InChIKey is ZPTOZGCACQWXJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO4/c1-13-6-4-2-3-5-7(6)10-9(12)14-8(5)11/h2-4H,1H3,(H,10,12).
What are the key properties of 8-methoxy-1H-3,1-benzoxazine-2,4-dione?
8-methoxy-1H-3,1-benzoxazine-2,4-dione has a molecular weight of 193.16 g/mol, XLogP of 0.49, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-1H-3,1-benzoxazine-2,4-dione is sourced from PubChem (CID 10559679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).