About 4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid
4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid (PubChem CID 10559787) has the molecular formula C9H8O3S
and a molecular weight of 196.23 g/mol. Its IUPAC name is 4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid.
Molecular Properties
| Compound Name | 4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid |
| PubChem CID | 10559787 |
| Molecular Formula | C9H8O3S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid |
| SMILES | O=C1CC(C(=O)O)Cc2sccc21 |
| InChI | InChI=1S/C9H8O3S/c10-7-3-5(9(11)12)4-8-6(7)1-2-13-8/h1-2,5H,3-4H2,(H,11,12) |
| InChIKey | NTXXIOJUCMZEKW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid?
The IUPAC name of 4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid (CID 10559787) is 4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid.
What is the SMILES notation for 4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid?
The canonical SMILES for 4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid is O=C1CC(C(=O)O)Cc2sccc21.
What is the InChIKey of 4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid?
The InChIKey is NTXXIOJUCMZEKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3S/c10-7-3-5(9(11)12)4-8-6(7)1-2-13-8/h1-2,5H,3-4H2,(H,11,12).
What are the key properties of 4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid?
4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid has a molecular weight of 196.23 g/mol, XLogP of 1.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-6,7-dihydro-5H-1-benzothiophene-6-carboxylic acid is sourced from PubChem (CID 10559787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).