About spiro[2,4-dihydrochromene-3,5'-pyrrolidine]-2'-one
spiro[2,4-dihydrochromene-3,5'-pyrrolidine]-2'-one (PubChem CID 10560073) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is spiro[2,4-dihydrochromene-3,5'-pyrrolidine]-2'-one.
Molecular Properties
| Compound Name | spiro[2,4-dihydrochromene-3,5'-pyrrolidine]-2'-one |
| PubChem CID | 10560073 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | spiro[2,4-dihydrochromene-3,5'-pyrrolidine]-2'-one |
| SMILES | O=C1CCC2(COc3ccccc3C2)N1 |
| InChI | InChI=1S/C12H13NO2/c14-11-5-6-12(13-11)7-9-3-1-2-4-10(9)15-8-12/h1-4H,5-8H2,(H,13,14) |
| InChIKey | UXGORTXJLZISLH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[2,4-dihydrochromene-3,5'-pyrrolidine]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2,4-dihydrochromene-3,5'-pyrrolidine]-2'-one?
The IUPAC name of spiro[2,4-dihydrochromene-3,5'-pyrrolidine]-2'-one (CID 10560073) is spiro[2,4-dihydrochromene-3,5'-pyrrolidine]-2'-one.
What is the SMILES notation for spiro[2,4-dihydrochromene-3,5'-pyrrolidine]-2'-one?
The canonical SMILES for spiro[2,4-dihydrochromene-3,5'-pyrrolidine]-2'-one is O=C1CCC2(COc3ccccc3C2)N1.
What is the InChIKey of spiro[2,4-dihydrochromene-3,5'-pyrrolidine]-2'-one?
The InChIKey is UXGORTXJLZISLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c14-11-5-6-12(13-11)7-9-3-1-2-4-10(9)15-8-12/h1-4H,5-8H2,(H,13,14).
What are the key properties of spiro[2,4-dihydrochromene-3,5'-pyrrolidine]-2'-one?
spiro[2,4-dihydrochromene-3,5'-pyrrolidine]-2'-one has a molecular weight of 203.24 g/mol, XLogP of 1.27, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2,4-dihydrochromene-3,5'-pyrrolidine]-2'-one is sourced from PubChem (CID 10560073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).