About 6-pentyl-3H-1,3-benzoxazol-2-one
6-pentyl-3H-1,3-benzoxazol-2-one (PubChem CID 10560176) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is 6-pentyl-3H-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 6-pentyl-3H-1,3-benzoxazol-2-one |
| PubChem CID | 10560176 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 6-pentyl-3H-1,3-benzoxazol-2-one |
| SMILES | CCCCCc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C12H15NO2/c1-2-3-4-5-9-6-7-10-11(8-9)15-12(14)13-10/h6-8H,2-5H2,1H3,(H,13,14) |
| InChIKey | OLWCRVGMYCIRPG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-pentyl-3H-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-pentyl-3H-1,3-benzoxazol-2-one?
The IUPAC name of 6-pentyl-3H-1,3-benzoxazol-2-one (CID 10560176) is 6-pentyl-3H-1,3-benzoxazol-2-one.
What is the SMILES notation for 6-pentyl-3H-1,3-benzoxazol-2-one?
The canonical SMILES for 6-pentyl-3H-1,3-benzoxazol-2-one is CCCCCc1ccc2[nH]c(=O)oc2c1.
What is the InChIKey of 6-pentyl-3H-1,3-benzoxazol-2-one?
The InChIKey is OLWCRVGMYCIRPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-2-3-4-5-9-6-7-10-11(8-9)15-12(14)13-10/h6-8H,2-5H2,1H3,(H,13,14).
What are the key properties of 6-pentyl-3H-1,3-benzoxazol-2-one?
6-pentyl-3H-1,3-benzoxazol-2-one has a molecular weight of 205.26 g/mol, XLogP of 2.85, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-pentyl-3H-1,3-benzoxazol-2-one is sourced from PubChem (CID 10560176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).