C13H18O2 — CID 10560215
1-[(6Z)-2-methyl-3a,4,5,8,9,9a-hexahydrocycloocta[b]furan-3-yl]ethanone (PubChem CID 10560215) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 1-[(6Z)-2-methyl-3a,4,5,8,9,9a-hexahydrocycloocta[b]furan-3-yl]ethanone.
| Compound Name | 1-[(6Z)-2-methyl-3a,4,5,8,9,9a-hexahydrocycloocta[b]furan-3-yl]ethanone |
|---|---|
| PubChem CID | 10560215 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 1-[(6Z)-2-methyl-3a,4,5,8,9,9a-hexahydrocycloocta[b]furan-3-yl]ethanone |
| SMILES | CC(=O)C1=C(C)OC2CC/C=C\CCC12 |
| InChI | InChI=1S/C13H18O2/c1-9(14)13-10(2)15-12-8-6-4-3-5-7-11(12)13/h3-4,11-12H,5-8H2,1-2H3/b4-3- |
| InChIKey | MLSKQBNESXKKFP-ARJAWSKDSA-N |
| XLogP | 2.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|