C11H14O4 — CID 10560372
3-(1,1-dihydroxyethyl)-4-[(1E,3E)-penta-1,3-dienyl]-2H-furan-5-one (PubChem CID 10560372) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-(1,1-dihydroxyethyl)-4-[(1E,3E)-penta-1,3-dienyl]-2H-furan-5-one.
| Compound Name | 3-(1,1-dihydroxyethyl)-4-[(1E,3E)-penta-1,3-dienyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 10560372 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 3-(1,1-dihydroxyethyl)-4-[(1E,3E)-penta-1,3-dienyl]-2H-furan-5-one |
| SMILES | C/C=C/C=C/C1=C(C(C)(O)O)COC1=O |
| InChI | InChI=1S/C11H14O4/c1-3-4-5-6-8-9(11(2,13)14)7-15-10(8)12/h3-6,13-14H,7H2,1-2H3/b4-3+,6-5+ |
| InChIKey | QDTFECJFZJEECZ-VNKDHWASSA-N |
| XLogP | 0.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|