C10H12O5 — CID 10560531
(1R,4R,6S,7S,9R,10S,11S)-1-deuterio-7-hydroxy-9-methyl-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one (PubChem CID 10560531) has the molecular formula C10H12O5 and a molecular weight of 213.21 g/mol. Its IUPAC name is (1R,4R,6S,7S,9R,10S,11S)-1-deuterio-7-hydroxy-9-methyl-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one.
| Compound Name | (1R,4R,6S,7S,9R,10S,11S)-1-deuterio-7-hydroxy-9-methyl-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one |
|---|---|
| PubChem CID | 10560531 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | (1R,4R,6S,7S,9R,10S,11S)-1-deuterio-7-hydroxy-9-methyl-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one |
| SMILES | [2H][C@@]12OC(=O)[C@@H]3C[C@H]4[C@@H]([C@@H]31)[C@](C)(O[C@@H]4O)O2 |
| InChI | InChI=1S/C10H12O5/c1-10-6-4(8(12)14-10)2-3-5(6)9(15-10)13-7(3)11/h3-6,8-9,12H,2H2,1H3/t3-,4+,5-,6+,8+,9+,10-/m1/s1/i9D |
| InChIKey | FKQDHUBITWNORZ-UZEUWYKXSA-N |
| XLogP | -0.17 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |