About 5-[6-(1,3-dioxolan-2-yl)-2-pyridinyl]-1,3-oxazole
5-[6-(1,3-dioxolan-2-yl)-2-pyridinyl]-1,3-oxazole (PubChem CID 10560747) has the molecular formula C11H10N2O3
and a molecular weight of 218.21 g/mol. Its IUPAC name is 5-[6-(1,3-dioxolan-2-yl)-2-pyridinyl]-1,3-oxazole.
Molecular Properties
| Compound Name | 5-[6-(1,3-dioxolan-2-yl)-2-pyridinyl]-1,3-oxazole |
| PubChem CID | 10560747 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 5-[6-(1,3-dioxolan-2-yl)-2-pyridinyl]-1,3-oxazole |
| SMILES | c1cc(-c2cnco2)nc(C2OCCO2)c1 |
| InChI | InChI=1S/C11H10N2O3/c1-2-8(10-6-12-7-16-10)13-9(3-1)11-14-4-5-15-11/h1-3,6-7,11H,4-5H2 |
| InChIKey | RIGYMLDOYLUWKN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[6-(1,3-dioxolan-2-yl)-2-pyridinyl]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[6-(1,3-dioxolan-2-yl)-2-pyridinyl]-1,3-oxazole?
The IUPAC name of 5-[6-(1,3-dioxolan-2-yl)-2-pyridinyl]-1,3-oxazole (CID 10560747) is 5-[6-(1,3-dioxolan-2-yl)-2-pyridinyl]-1,3-oxazole.
What is the SMILES notation for 5-[6-(1,3-dioxolan-2-yl)-2-pyridinyl]-1,3-oxazole?
The canonical SMILES for 5-[6-(1,3-dioxolan-2-yl)-2-pyridinyl]-1,3-oxazole is c1cc(-c2cnco2)nc(C2OCCO2)c1.
What is the InChIKey of 5-[6-(1,3-dioxolan-2-yl)-2-pyridinyl]-1,3-oxazole?
The InChIKey is RIGYMLDOYLUWKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O3/c1-2-8(10-6-12-7-16-10)13-9(3-1)11-14-4-5-15-11/h1-3,6-7,11H,4-5H2.
What are the key properties of 5-[6-(1,3-dioxolan-2-yl)-2-pyridinyl]-1,3-oxazole?
5-[6-(1,3-dioxolan-2-yl)-2-pyridinyl]-1,3-oxazole has a molecular weight of 218.21 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[6-(1,3-dioxolan-2-yl)-2-pyridinyl]-1,3-oxazole is sourced from PubChem (CID 10560747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).