C10H11N3OS — CID 10560946
8-ethyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 10560946) has the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. Its IUPAC name is 8-ethyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-ethyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 10560946 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 8-ethyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCn1c(=O)ccc2cnc(SC)nc21 |
| InChI | InChI=1S/C10H11N3OS/c1-3-13-8(14)5-4-7-6-11-10(15-2)12-9(7)13/h4-6H,3H2,1-2H3 |
| InChIKey | RNYUFDKLBWLNCR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |