C14H20FN — CID 10560954
(2R)-N-butyl-5-fluoro-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 10560954) has the molecular formula C14H20FN and a molecular weight of 221.32 g/mol. Its IUPAC name is (2R)-N-butyl-5-fluoro-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (2R)-N-butyl-5-fluoro-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 10560954 |
| Molecular Formula | C14H20FN |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | (2R)-N-butyl-5-fluoro-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCCN[C@@H]1CCc2c(F)cccc2C1 |
| InChI | InChI=1S/C14H20FN/c1-2-3-9-16-12-7-8-13-11(10-12)5-4-6-14(13)15/h4-6,12,16H,2-3,7-10H2,1H3/t12-/m1/s1 |
| InChIKey | VXPJDPSEYZZZEM-GFCCVEGCSA-N |
| XLogP | 3.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|