C12H16O4 — CID 10561087
(1S,5S,8S,11R)-10-methoxy-7-methylidene-2-oxatricyclo[6.3.0.01,5]undec-9-ene-8,11-diol (PubChem CID 10561087) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (1S,5S,8S,11R)-10-methoxy-7-methylidene-2-oxatricyclo[6.3.0.01,5]undec-9-ene-8,11-diol.
| Compound Name | (1S,5S,8S,11R)-10-methoxy-7-methylidene-2-oxatricyclo[6.3.0.01,5]undec-9-ene-8,11-diol |
|---|---|
| PubChem CID | 10561087 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (1S,5S,8S,11R)-10-methoxy-7-methylidene-2-oxatricyclo[6.3.0.01,5]undec-9-ene-8,11-diol |
| SMILES | C=C1C[C@H]2CCO[C@]23[C@H](O)C(OC)=C[C@]13O |
| InChI | InChI=1S/C12H16O4/c1-7-5-8-3-4-16-12(8)10(13)9(15-2)6-11(7,12)14/h6,8,10,13-14H,1,3-5H2,2H3/t8-,10-,11+,12+/m1/s1 |
| InChIKey | YNHLJKDLQRWTLB-YJQGPUDQSA-N |
| XLogP | 0.36 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|