About N-[4-methoxy-2,6-bis(methylamino)pyrimidin-5-yl]-N-methylformamide
N-[4-methoxy-2,6-bis(methylamino)pyrimidin-5-yl]-N-methylformamide (PubChem CID 10561164) has the molecular formula C9H15N5O2
and a molecular weight of 225.25 g/mol. Its IUPAC name is N-[4-methoxy-2,6-bis(methylamino)pyrimidin-5-yl]-N-methylformamide.
Molecular Properties
| Compound Name | N-[4-methoxy-2,6-bis(methylamino)pyrimidin-5-yl]-N-methylformamide |
| PubChem CID | 10561164 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | N-[4-methoxy-2,6-bis(methylamino)pyrimidin-5-yl]-N-methylformamide |
| SMILES | CNc1nc(NC)c(N(C)C=O)c(OC)n1 |
| InChI | InChI=1S/C9H15N5O2/c1-10-7-6(14(3)5-15)8(16-4)13-9(11-2)12-7/h5H,1-4H3,(H2,10,11,12,13) |
| InChIKey | AYPVLECRVLOFKA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[4-methoxy-2,6-bis(methylamino)pyrimidin-5-yl]-N-methylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-methoxy-2,6-bis(methylamino)pyrimidin-5-yl]-N-methylformamide?
The IUPAC name of N-[4-methoxy-2,6-bis(methylamino)pyrimidin-5-yl]-N-methylformamide (CID 10561164) is N-[4-methoxy-2,6-bis(methylamino)pyrimidin-5-yl]-N-methylformamide.
What is the SMILES notation for N-[4-methoxy-2,6-bis(methylamino)pyrimidin-5-yl]-N-methylformamide?
The canonical SMILES for N-[4-methoxy-2,6-bis(methylamino)pyrimidin-5-yl]-N-methylformamide is CNc1nc(NC)c(N(C)C=O)c(OC)n1.
What is the InChIKey of N-[4-methoxy-2,6-bis(methylamino)pyrimidin-5-yl]-N-methylformamide?
The InChIKey is AYPVLECRVLOFKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O2/c1-10-7-6(14(3)5-15)8(16-4)13-9(11-2)12-7/h5H,1-4H3,(H2,10,11,12,13).
What are the key properties of N-[4-methoxy-2,6-bis(methylamino)pyrimidin-5-yl]-N-methylformamide?
N-[4-methoxy-2,6-bis(methylamino)pyrimidin-5-yl]-N-methylformamide has a molecular weight of 225.25 g/mol, XLogP of 0.16, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-methoxy-2,6-bis(methylamino)pyrimidin-5-yl]-N-methylformamide is sourced from PubChem (CID 10561164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).