C14H27NO — CID 10561177
(1R,2S,5R)-2-[2-(but-3-enylamino)propan-2-yl]-5-methylcyclohexan-1-ol (PubChem CID 10561177) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is (1R,2S,5R)-2-[2-(but-3-enylamino)propan-2-yl]-5-methylcyclohexan-1-ol.
| Compound Name | (1R,2S,5R)-2-[2-(but-3-enylamino)propan-2-yl]-5-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 10561177 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | (1R,2S,5R)-2-[2-(but-3-enylamino)propan-2-yl]-5-methylcyclohexan-1-ol |
| SMILES | C=CCCNC(C)(C)[C@@H]1CC[C@@H](C)C[C@H]1O |
| InChI | InChI=1S/C14H27NO/c1-5-6-9-15-14(3,4)12-8-7-11(2)10-13(12)16/h5,11-13,15-16H,1,6-10H2,2-4H3/t11-,12-,13-/m1/s1 |
| InChIKey | OTMVSWAGYXULCO-JHJVBQTASA-N |
| XLogP | 2.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|