C14H16N2O — CID 10561331
5-(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-1H-imidazole (PubChem CID 10561331) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is 5-(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-1H-imidazole.
| Compound Name | 5-(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-1H-imidazole |
|---|---|
| PubChem CID | 10561331 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 5-(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-1H-imidazole |
| SMILES | COc1cccc2c1CCCC2c1cnc[nH]1 |
| InChI | InChI=1S/C14H16N2O/c1-17-14-7-3-4-10-11(5-2-6-12(10)14)13-8-15-9-16-13/h3-4,7-9,11H,2,5-6H2,1H3,(H,15,16) |
| InChIKey | XVZVIENUEBLQBC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |