About tert-butyl 2-[(2S,6S)-6-methylthian-2-yl]acetate
tert-butyl 2-[(2S,6S)-6-methylthian-2-yl]acetate (PubChem CID 10561471) has the molecular formula C12H22O2S
and a molecular weight of 230.37 g/mol. Its IUPAC name is tert-butyl 2-[(2S,6S)-6-methylthian-2-yl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[(2S,6S)-6-methylthian-2-yl]acetate |
| PubChem CID | 10561471 |
| Molecular Formula | C12H22O2S |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | tert-butyl 2-[(2S,6S)-6-methylthian-2-yl]acetate |
| SMILES | C[C@H]1CCC[C@@H](CC(=O)OC(C)(C)C)S1 |
| InChI | InChI=1S/C12H22O2S/c1-9-6-5-7-10(15-9)8-11(13)14-12(2,3)4/h9-10H,5-8H2,1-4H3/t9-,10-/m0/s1 |
| InChIKey | LDZWQMDLZKBKBW-UWVGGRQHSA-N |
| XLogP | 3.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 2-[(2S,6S)-6-methylthian-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(2S,6S)-6-methylthian-2-yl]acetate?
The IUPAC name of tert-butyl 2-[(2S,6S)-6-methylthian-2-yl]acetate (CID 10561471) is tert-butyl 2-[(2S,6S)-6-methylthian-2-yl]acetate.
What is the SMILES notation for tert-butyl 2-[(2S,6S)-6-methylthian-2-yl]acetate?
The canonical SMILES for tert-butyl 2-[(2S,6S)-6-methylthian-2-yl]acetate is C[C@H]1CCC[C@@H](CC(=O)OC(C)(C)C)S1.
What is the InChIKey of tert-butyl 2-[(2S,6S)-6-methylthian-2-yl]acetate?
The InChIKey is LDZWQMDLZKBKBW-UWVGGRQHSA-N. The full InChI is InChI=1S/C12H22O2S/c1-9-6-5-7-10(15-9)8-11(13)14-12(2,3)4/h9-10H,5-8H2,1-4H3/t9-,10-/m0/s1.
What are the key properties of tert-butyl 2-[(2S,6S)-6-methylthian-2-yl]acetate?
tert-butyl 2-[(2S,6S)-6-methylthian-2-yl]acetate has a molecular weight of 230.37 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(2S,6S)-6-methylthian-2-yl]acetate is sourced from PubChem (CID 10561471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).