C12H13N3S — CID 10561514
3-(3-methyl-2-pyridinyl)-1,4,5,6-tetrahydrocyclopenta[d]imidazole-2-thione (PubChem CID 10561514) has the molecular formula C12H13N3S and a molecular weight of 231.32 g/mol. Its IUPAC name is 3-(3-methyl-2-pyridinyl)-1,4,5,6-tetrahydrocyclopenta[d]imidazole-2-thione.
| Compound Name | 3-(3-methyl-2-pyridinyl)-1,4,5,6-tetrahydrocyclopenta[d]imidazole-2-thione |
|---|---|
| PubChem CID | 10561514 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 3-(3-methyl-2-pyridinyl)-1,4,5,6-tetrahydrocyclopenta[d]imidazole-2-thione |
| SMILES | Cc1cccnc1-n1c2c([nH]c1=S)CCC2 |
| InChI | InChI=1S/C12H13N3S/c1-8-4-3-7-13-11(8)15-10-6-2-5-9(10)14-12(15)16/h3-4,7H,2,5-6H2,1H3,(H,14,16) |
| InChIKey | WETFPUSBTLUJNU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|