C17H12O — CID 10561550
2-ethynyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-ol (PubChem CID 10561550) has the molecular formula C17H12O and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-ethynyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-ol.
| Compound Name | 2-ethynyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-ol |
|---|---|
| PubChem CID | 10561550 |
| Molecular Formula | C17H12O |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 2-ethynyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-ol |
| SMILES | C#CC1(O)c2ccccc2C=Cc2ccccc21 |
| InChI | InChI=1S/C17H12O/c1-2-17(18)15-9-5-3-7-13(15)11-12-14-8-4-6-10-16(14)17/h1,3-12,18H |
| InChIKey | UOSAKNPCDSLQPQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|