About [(5S)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanone
[(5S)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanone (PubChem CID 10561980) has the molecular formula C13H21NO3
and a molecular weight of 239.31 g/mol. Its IUPAC name is [(5S)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanone.
Molecular Properties
| Compound Name | [(5S)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanone |
| PubChem CID | 10561980 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | [(5S)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanone |
| SMILES | COC[C@@H]1CCCN1C(=O)[C@@]1(C)OCC=C1C |
| InChI | InChI=1S/C13H21NO3/c1-10-6-8-17-13(10,2)12(15)14-7-4-5-11(14)9-16-3/h6,11H,4-5,7-9H2,1-3H3/t11-,13-/m0/s1 |
| InChIKey | USPJGSUMRBSMSN-AAEUAGOBSA-N |
| XLogP | 1.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(5S)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanone?
The IUPAC name of [(5S)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanone (CID 10561980) is [(5S)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanone.
What is the SMILES notation for [(5S)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanone?
The canonical SMILES for [(5S)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanone is COC[C@@H]1CCCN1C(=O)[C@@]1(C)OCC=C1C.
What is the InChIKey of [(5S)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanone?
The InChIKey is USPJGSUMRBSMSN-AAEUAGOBSA-N. The full InChI is InChI=1S/C13H21NO3/c1-10-6-8-17-13(10,2)12(15)14-7-4-5-11(14)9-16-3/h6,11H,4-5,7-9H2,1-3H3/t11-,13-/m0/s1.
What are the key properties of [(5S)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanone?
[(5S)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanone has a molecular weight of 239.31 g/mol, XLogP of 1.36, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S)-4,5-dimethyl-2H-furan-5-yl]-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanone is sourced from PubChem (CID 10561980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).