About 3-phenyl-8H-pyrimido[4,5-c]pyridazine-5,7-dione
3-phenyl-8H-pyrimido[4,5-c]pyridazine-5,7-dione (PubChem CID 10562005) has the molecular formula C12H8N4O2
and a molecular weight of 240.22 g/mol. Its IUPAC name is 3-phenyl-8H-pyrimido[4,5-c]pyridazine-5,7-dione.
Molecular Properties
| Compound Name | 3-phenyl-8H-pyrimido[4,5-c]pyridazine-5,7-dione |
| PubChem CID | 10562005 |
| Molecular Formula | C12H8N4O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 3-phenyl-8H-pyrimido[4,5-c]pyridazine-5,7-dione |
| SMILES | O=c1[nH]c(=O)c2cc(-c3ccccc3)nnc2[nH]1 |
| InChI | InChI=1S/C12H8N4O2/c17-11-8-6-9(7-4-2-1-3-5-7)15-16-10(8)13-12(18)14-11/h1-6H,(H2,13,14,16,17,18) |
| InChIKey | CZBTUGZPGBQGNS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-phenyl-8H-pyrimido[4,5-c]pyridazine-5,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-8H-pyrimido[4,5-c]pyridazine-5,7-dione?
The IUPAC name of 3-phenyl-8H-pyrimido[4,5-c]pyridazine-5,7-dione (CID 10562005) is 3-phenyl-8H-pyrimido[4,5-c]pyridazine-5,7-dione.
What is the SMILES notation for 3-phenyl-8H-pyrimido[4,5-c]pyridazine-5,7-dione?
The canonical SMILES for 3-phenyl-8H-pyrimido[4,5-c]pyridazine-5,7-dione is O=c1[nH]c(=O)c2cc(-c3ccccc3)nnc2[nH]1.
What is the InChIKey of 3-phenyl-8H-pyrimido[4,5-c]pyridazine-5,7-dione?
The InChIKey is CZBTUGZPGBQGNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4O2/c17-11-8-6-9(7-4-2-1-3-5-7)15-16-10(8)13-12(18)14-11/h1-6H,(H2,13,14,16,17,18).
What are the key properties of 3-phenyl-8H-pyrimido[4,5-c]pyridazine-5,7-dione?
3-phenyl-8H-pyrimido[4,5-c]pyridazine-5,7-dione has a molecular weight of 240.22 g/mol, XLogP of 0.67, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-8H-pyrimido[4,5-c]pyridazine-5,7-dione is sourced from PubChem (CID 10562005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).