C12H8N4S — CID 10562020
17-thia-8,11,13,14-tetrazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,12,14-heptaene (PubChem CID 10562020) has the molecular formula C12H8N4S and a molecular weight of 240.29 g/mol. Its IUPAC name is 17-thia-8,11,13,14-tetrazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,12,14-heptaene.
| Compound Name | 17-thia-8,11,13,14-tetrazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,12,14-heptaene |
|---|---|
| PubChem CID | 10562020 |
| Molecular Formula | C12H8N4S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 17-thia-8,11,13,14-tetrazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,8,12,14-heptaene |
| SMILES | c1ccc2c3c(cnc2c1)-n1cnnc1CS3 |
| InChI | InChI=1S/C12H8N4S/c1-2-4-9-8(3-1)12-10(5-13-9)16-7-14-15-11(16)6-17-12/h1-5,7H,6H2 |
| InChIKey | XRHVLHVQVXFCDD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |