About (3Z)-8-methyl-4-(trimethylsilylmethyl)nona-3,7-dien-1-ol
(3Z)-8-methyl-4-(trimethylsilylmethyl)nona-3,7-dien-1-ol (PubChem CID 10562060) has the molecular formula C14H28OSi
and a molecular weight of 240.46 g/mol. Its IUPAC name is (3Z)-8-methyl-4-(trimethylsilylmethyl)nona-3,7-dien-1-ol.
Molecular Properties
| Compound Name | (3Z)-8-methyl-4-(trimethylsilylmethyl)nona-3,7-dien-1-ol |
| PubChem CID | 10562060 |
| Molecular Formula | C14H28OSi |
| Molecular Weight | 240.46 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | (3Z)-8-methyl-4-(trimethylsilylmethyl)nona-3,7-dien-1-ol |
| SMILES | CC(C)=CCC/C(=C/CCO)C[Si](C)(C)C |
| InChI | InChI=1S/C14H28OSi/c1-13(2)8-6-9-14(10-7-11-15)12-16(3,4)5/h8,10,15H,6-7,9,11-12H2,1-5H3/b14-10- |
| InChIKey | FJETVNOMNBBQEU-UVTDQMKNSA-N |
| XLogP | 4.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-8-methyl-4-(trimethylsilylmethyl)nona-3,7-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-8-methyl-4-(trimethylsilylmethyl)nona-3,7-dien-1-ol?
The IUPAC name of (3Z)-8-methyl-4-(trimethylsilylmethyl)nona-3,7-dien-1-ol (CID 10562060) is (3Z)-8-methyl-4-(trimethylsilylmethyl)nona-3,7-dien-1-ol.
What is the SMILES notation for (3Z)-8-methyl-4-(trimethylsilylmethyl)nona-3,7-dien-1-ol?
The canonical SMILES for (3Z)-8-methyl-4-(trimethylsilylmethyl)nona-3,7-dien-1-ol is CC(C)=CCC/C(=C/CCO)C[Si](C)(C)C.
What is the InChIKey of (3Z)-8-methyl-4-(trimethylsilylmethyl)nona-3,7-dien-1-ol?
The InChIKey is FJETVNOMNBBQEU-UVTDQMKNSA-N. The full InChI is InChI=1S/C14H28OSi/c1-13(2)8-6-9-14(10-7-11-15)12-16(3,4)5/h8,10,15H,6-7,9,11-12H2,1-5H3/b14-10-.
What are the key properties of (3Z)-8-methyl-4-(trimethylsilylmethyl)nona-3,7-dien-1-ol?
(3Z)-8-methyl-4-(trimethylsilylmethyl)nona-3,7-dien-1-ol has a molecular weight of 240.46 g/mol, XLogP of 4.38, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-8-methyl-4-(trimethylsilylmethyl)nona-3,7-dien-1-ol is sourced from PubChem (CID 10562060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).