C14H29NO2 — CID 10562206
(Z,2R,3R)-2-aminotetradec-7-ene-1,3-diol (PubChem CID 10562206) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is (Z,2R,3R)-2-aminotetradec-7-ene-1,3-diol.
| Compound Name | (Z,2R,3R)-2-aminotetradec-7-ene-1,3-diol |
|---|---|
| PubChem CID | 10562206 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | (Z,2R,3R)-2-aminotetradec-7-ene-1,3-diol |
| SMILES | CCCCCC/C=C\CCC[C@@H](O)[C@H](N)CO |
| InChI | InChI=1S/C14H29NO2/c1-2-3-4-5-6-7-8-9-10-11-14(17)13(15)12-16/h7-8,13-14,16-17H,2-6,9-12,15H2,1H3/b8-7-/t13-,14-/m1/s1 |
| InChIKey | GAPOVTCESQJLFA-JUBSNLHESA-N |
| XLogP | 2.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|