C7H11F3N2O4 — CID 10562222
(6S)-6-(hydroxymethyl)piperazin-4-ium-2-one;2,2,2-trifluoroacetate (PubChem CID 10562222) has the molecular formula C7H11F3N2O4 and a molecular weight of 244.17 g/mol. Its IUPAC name is (6S)-6-(hydroxymethyl)piperazin-4-ium-2-one;2,2,2-trifluoroacetate.
| Compound Name | (6S)-6-(hydroxymethyl)piperazin-4-ium-2-one;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10562222 |
| Molecular Formula | C7H11F3N2O4 |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (6S)-6-(hydroxymethyl)piperazin-4-ium-2-one;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.O=C1C[NH2+]C[C@@H](CO)N1 |
| InChI | InChI=1S/C5H10N2O2.C2HF3O2/c8-3-4-1-6-2-5(9)7-4;3-2(4,5)1(6)7/h4,6,8H,1-3H2,(H,7,9);(H,6,7)/t4-;/m0./s1 |
| InChIKey | PJBAUDOEOVOMET-WCCKRBBISA-N |
| XLogP | -3.66 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |