C14H23NOSi — CID 10562724
(1R,3S,4R,6S,8R)-4-(18O)trimethylsilyloxytricyclo[4.3.1.03,8]decane-4-carbonitrile (PubChem CID 10562724) has the molecular formula C14H23NOSi and a molecular weight of 251.43 g/mol. Its IUPAC name is (1R,3S,4R,6S,8R)-4-(18O)trimethylsilyloxytricyclo[4.3.1.03,8]decane-4-carbonitrile.
| Compound Name | (1R,3S,4R,6S,8R)-4-(18O)trimethylsilyloxytricyclo[4.3.1.03,8]decane-4-carbonitrile |
|---|---|
| PubChem CID | 10562724 |
| Molecular Formula | C14H23NOSi |
| Molecular Weight | 251.43 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | (1R,3S,4R,6S,8R)-4-(18O)trimethylsilyloxytricyclo[4.3.1.03,8]decane-4-carbonitrile |
| SMILES | C[Si](C)(C)[18O][C@]1(C#N)C[C@H]2C[C@@H]3C[C@H](C2)[C@@H]1C3 |
| InChI | InChI=1S/C14H23NOSi/c1-17(2,3)16-14(9-15)8-11-4-10-5-12(6-11)13(14)7-10/h10-13H,4-8H2,1-3H3/t10-,11+,12-,13+,14+/m1/s1/i16+2 |
| InChIKey | BDNQLLMJXPVELJ-TVVLPKRSSA-N |
| XLogP | 3.56 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|